C42H33F3N2O3S — CID 142521162
[3-[2-[6-[(2E,4Z)-hepta-2,4-dien-2-yl]-3-pyridinyl]phenyl]-5-[2-(4-pyridin-2-ylphenyl)phenyl]phenyl] trifluoromethanesulfonate (PubChem CID 142521162) has the molecular formula C42H33F3N2O3S and a molecular weight of 702.80 g/mol. Its IUPAC name is [3-[2-[6-[(2E,4Z)-hepta-2,4-dien-2-yl]-3-pyridinyl]phenyl]-5-[2-(4-pyridin-2-ylphenyl)phenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[2-[6-[(2E,4Z)-hepta-2,4-dien-2-yl]-3-pyridinyl]phenyl]-5-[2-(4-pyridin-2-ylphenyl)phenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142521162 |
| Molecular Formula | C42H33F3N2O3S |
| Molecular Weight | 702.80 g/mol |
| Exact Mass | 702.22 |
| IUPAC Name | [3-[2-[6-[(2E,4Z)-hepta-2,4-dien-2-yl]-3-pyridinyl]phenyl]-5-[2-(4-pyridin-2-ylphenyl)phenyl]phenyl] trifluoromethanesulfonate |
| SMILES | CC/C=C\C=C(/C)c1ccc(-c2ccccc2-c2cc(OS(=O)(=O)C(F)(F)F)cc(-c3ccccc3-c3ccc(-c4ccccn4)cc3)c2)cn1 |
| InChI | InChI=1S/C42H33F3N2O3S/c1-3-4-5-12-29(2)40-23-22-32(28-47-40)37-14-7-9-16-39(37)34-25-33(26-35(27-34)50-51(48,49)42(43,44)45)38-15-8-6-13-36(38)30-18-20-31(21-19-30)41-17-10-11-24-46-41/h4-28H,3H2,1-2H3/b5-4-,29-12+ |
| InChIKey | SQMJJLSUDHIKLE-KYMHBGJHSA-N |
| XLogP | 11.41 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.80 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|