C50H38F3N3O4S — CID 142521194
[3-[4,5-dimethyl-2-(4-pyridin-2-ylphenyl)phenyl]-5-[2-[6-[3-ethenyl-2-(propan-2-ylideneamino)-1-benzofuran-7-yl]-3-pyridinyl]phenyl]phenyl] trifluoromethanesulfonate (PubChem CID 142521194) has the molecular formula C50H38F3N3O4S and a molecular weight of 833.93 g/mol. Its IUPAC name is [3-[4,5-dimethyl-2-(4-pyridin-2-ylphenyl)phenyl]-5-[2-[6-[3-ethenyl-2-(propan-2-ylideneamino)-1-benzofuran-7-yl]-3-pyridinyl]phenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[4,5-dimethyl-2-(4-pyridin-2-ylphenyl)phenyl]-5-[2-[6-[3-ethenyl-2-(propan-2-ylideneamino)-1-benzofuran-7-yl]-3-pyridinyl]phenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142521194 |
| Molecular Formula | C50H38F3N3O4S |
| Molecular Weight | 833.93 g/mol |
| Exact Mass | 833.25 |
| IUPAC Name | [3-[4,5-dimethyl-2-(4-pyridin-2-ylphenyl)phenyl]-5-[2-[6-[3-ethenyl-2-(propan-2-ylideneamino)-1-benzofuran-7-yl]-3-pyridinyl]phenyl]phenyl] trifluoromethanesulfonate |
| SMILES | C=Cc1c(N=C(C)C)oc2c(-c3ccc(-c4ccccc4-c4cc(OS(=O)(=O)C(F)(F)F)cc(-c5cc(C)c(C)cc5-c5ccc(-c6ccccn6)cc5)c4)cn3)cccc12 |
| InChI | InChI=1S/C50H38F3N3O4S/c1-6-39-42-14-11-15-43(48(42)59-49(39)56-30(2)3)47-22-21-35(29-55-47)40-12-7-8-13-41(40)36-26-37(28-38(27-36)60-61(57,58)50(51,52)53)45-25-32(5)31(4)24-44(45)33-17-19-34(20-18-33)46-16-9-10-23-54-46/h6-29H,1H2,2-5H3 |
| InChIKey | KXBRTWYGZTWGRV-UHFFFAOYSA-N |
| XLogP | 13.83 |
| TPSA | 94.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.93 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|