C19H13ClFN5O4 — CID 142521605
3-[4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazol-5-yl]-6-nitrobenzimidazole-4-carboxylic acid (PubChem CID 142521605) has the molecular formula C19H13ClFN5O4 and a molecular weight of 429.80 g/mol. Its IUPAC name is 3-[4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazol-5-yl]-6-nitrobenzimidazole-4-carboxylic acid.
| Compound Name | 3-[4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazol-5-yl]-6-nitrobenzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 142521605 |
| Molecular Formula | C19H13ClFN5O4 |
| Molecular Weight | 429.80 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 3-[4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazol-5-yl]-6-nitrobenzimidazole-4-carboxylic acid |
| SMILES | Cc1nn(C)c(-n2cnc3cc([N+](=O)[O-])cc(C(=O)O)c32)c1-c1ccc(F)cc1Cl |
| InChI | InChI=1S/C19H13ClFN5O4/c1-9-16(12-4-3-10(21)5-14(12)20)18(24(2)23-9)25-8-22-15-7-11(26(29)30)6-13(17(15)25)19(27)28/h3-8H,1-2H3,(H,27,28) |
| InChIKey | QCKMOZNHNDCLJS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.80 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|