C21H18IN3O3 — CID 142521999
2-[[5-iodo-1-(oxan-2-yl)indazol-4-yl]methyl]isoindole-1,3-dione (PubChem CID 142521999) has the molecular formula C21H18IN3O3 and a molecular weight of 487.30 g/mol. Its IUPAC name is 2-[[5-iodo-1-(oxan-2-yl)indazol-4-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-iodo-1-(oxan-2-yl)indazol-4-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142521999 |
| Molecular Formula | C21H18IN3O3 |
| Molecular Weight | 487.30 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | 2-[[5-iodo-1-(oxan-2-yl)indazol-4-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1c(I)ccc2c1cnn2C1CCCCO1 |
| InChI | InChI=1S/C21H18IN3O3/c22-17-8-9-18-15(11-23-25(18)19-7-3-4-10-28-19)16(17)12-24-20(26)13-5-1-2-6-14(13)21(24)27/h1-2,5-6,8-9,11,19H,3-4,7,10,12H2 |
| InChIKey | TVYRSQXHLNISDH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|