About ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine
ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine (PubChem CID 142522589) has the molecular formula C11H20N4S
and a molecular weight of 240.38 g/mol. Its IUPAC name is ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine.
Molecular Properties
| Compound Name | ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine |
| PubChem CID | 142522589 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine |
| SMILES | C=CN.CNCc1ccc(SNNC)cc1 |
| InChI | InChI=1S/C9H15N3S.C2H5N/c1-10-7-8-3-5-9(6-4-8)13-12-11-2;1-2-3/h3-6,10-12H,7H2,1-2H3;2H,1,3H2 |
| InChIKey | LMQCEJJFHFFFQK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine?
The IUPAC name of ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine (CID 142522589) is ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine.
What is the SMILES notation for ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine?
The canonical SMILES for ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine is C=CN.CNCc1ccc(SNNC)cc1.
What is the InChIKey of ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine?
The InChIKey is LMQCEJJFHFFFQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3S.C2H5N/c1-10-7-8-3-5-9(6-4-8)13-12-11-2;1-2-3/h3-6,10-12H,7H2,1-2H3;2H,1,3H2.
What are the key properties of ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine?
ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine has a molecular weight of 240.38 g/mol, XLogP of 1.23, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethenamine;N-methyl-1-[4-(2-methylhydrazinyl)sulfanylphenyl]methanamine is sourced from PubChem (CID 142522589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).