C10H16O4 — CID 142523941
ethane;methyl (2E,4Z)-5-formyloxy-2-methylpenta-2,4-dienoate (PubChem CID 142523941) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is ethane;methyl (2E,4Z)-5-formyloxy-2-methylpenta-2,4-dienoate.
| Compound Name | ethane;methyl (2E,4Z)-5-formyloxy-2-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 142523941 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | ethane;methyl (2E,4Z)-5-formyloxy-2-methylpenta-2,4-dienoate |
| SMILES | CC.COC(=O)/C(C)=C/C=C\OC=O |
| InChI | InChI=1S/C8H10O4.C2H6/c1-7(8(10)11-2)4-3-5-12-6-9;1-2/h3-6H,1-2H3;1-2H3/b5-3-,7-4+; |
| InChIKey | UNNKSVYBLPMKJH-JQEBEGLOSA-N |
| XLogP | 1.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|