C13H29N3O4 — CID 142525201
tert-butyl N-[3-[3-(ethoxyamino)oxypropylamino]propyl]carbamate (PubChem CID 142525201) has the molecular formula C13H29N3O4 and a molecular weight of 291.39 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(ethoxyamino)oxypropylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(ethoxyamino)oxypropylamino]propyl]carbamate |
|---|---|
| PubChem CID | 142525201 |
| Molecular Formula | C13H29N3O4 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | tert-butyl N-[3-[3-(ethoxyamino)oxypropylamino]propyl]carbamate |
| SMILES | CCONOCCCNCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H29N3O4/c1-5-18-16-19-11-7-9-14-8-6-10-15-12(17)20-13(2,3)4/h14,16H,5-11H2,1-4H3,(H,15,17) |
| InChIKey | HSXRNLKFLXVARL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|