C11H24N4 — CID 142526209
N'-[3-(2-methylidene-1,3-diazinan-1-yl)propyl]propane-1,3-diamine (PubChem CID 142526209) has the molecular formula C11H24N4 and a molecular weight of 212.34 g/mol. Its IUPAC name is N'-[3-(2-methylidene-1,3-diazinan-1-yl)propyl]propane-1,3-diamine.
| Compound Name | N'-[3-(2-methylidene-1,3-diazinan-1-yl)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 142526209 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | N'-[3-(2-methylidene-1,3-diazinan-1-yl)propyl]propane-1,3-diamine |
| SMILES | C=C1NCCCN1CCCNCCCN |
| InChI | InChI=1S/C11H24N4/c1-11-14-8-4-10-15(11)9-3-7-13-6-2-5-12/h13-14H,1-10,12H2 |
| InChIKey | PTOKDZCKIMKLGC-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|