C23H22N5O2+ — CID 142527646
N-cyclopropyl-7-methoxy-5-[4-(1-methylpyrazol-4-yl)phenyl]-1,7-naphthyridin-7-ium-3-carboxamide (PubChem CID 142527646) has the molecular formula C23H22N5O2+ and a molecular weight of 400.46 g/mol. Its IUPAC name is N-cyclopropyl-7-methoxy-5-[4-(1-methylpyrazol-4-yl)phenyl]-1,7-naphthyridin-7-ium-3-carboxamide.
| Compound Name | N-cyclopropyl-7-methoxy-5-[4-(1-methylpyrazol-4-yl)phenyl]-1,7-naphthyridin-7-ium-3-carboxamide |
|---|---|
| PubChem CID | 142527646 |
| Molecular Formula | C23H22N5O2+ |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-cyclopropyl-7-methoxy-5-[4-(1-methylpyrazol-4-yl)phenyl]-1,7-naphthyridin-7-ium-3-carboxamide |
| SMILES | CO[n+]1cc(-c2ccc(-c3cnn(C)c3)cc2)c2cc(C(=O)NC3CC3)cnc2c1 |
| InChI | InChI=1S/C23H21N5O2/c1-27-12-18(11-25-27)15-3-5-16(6-4-15)21-13-28(30-2)14-22-20(21)9-17(10-24-22)23(29)26-19-7-8-19/h3-6,9-14,19H,7-8H2,1-2H3/p+1 |
| InChIKey | CURPFSQEMGKAKE-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|