C13H18N2 — CID 142527752
3-methyl-2-methylidene-1-prop-2-enyl-5,6,7,8-tetrahydroquinoxaline (PubChem CID 142527752) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-methyl-2-methylidene-1-prop-2-enyl-5,6,7,8-tetrahydroquinoxaline.
| Compound Name | 3-methyl-2-methylidene-1-prop-2-enyl-5,6,7,8-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 142527752 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-methyl-2-methylidene-1-prop-2-enyl-5,6,7,8-tetrahydroquinoxaline |
| SMILES | C=CCN1C(=C)C(C)=NC2=C1CCCC2 |
| InChI | InChI=1S/C13H18N2/c1-4-9-15-11(3)10(2)14-12-7-5-6-8-13(12)15/h4H,1,3,5-9H2,2H3 |
| InChIKey | XVYUOOMAFRSFEW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|