C12H17N3 — CID 91094632
N,N-dimethyl-8-methylimino-4,9-dihydroquinolizin-1-amine (PubChem CID 91094632) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is N,N-dimethyl-8-methylimino-4,9-dihydroquinolizin-1-amine.
| Compound Name | N,N-dimethyl-8-methylimino-4,9-dihydroquinolizin-1-amine |
|---|---|
| PubChem CID | 91094632 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N,N-dimethyl-8-methylimino-4,9-dihydroquinolizin-1-amine |
| SMILES | C/N=C1\C=CN2CC=CC(N(C)C)=C2C1 |
| InChI | InChI=1S/C12H17N3/c1-13-10-6-8-15-7-4-5-11(14(2)3)12(15)9-10/h4-6,8H,7,9H2,1-3H3/b13-10+ |
| InChIKey | LLRBJHFWYFGIAH-JLHYYAGUSA-N |
| XLogP | 1.62 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|