C17H24N2O3 — CID 142527789
methyl 3-cyclopropyl-2-[4-[(3E)-hexa-1,3,5-trien-3-yl]piperazin-1-yl]-3-oxopropanoate (PubChem CID 142527789) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 3-cyclopropyl-2-[4-[(3E)-hexa-1,3,5-trien-3-yl]piperazin-1-yl]-3-oxopropanoate.
| Compound Name | methyl 3-cyclopropyl-2-[4-[(3E)-hexa-1,3,5-trien-3-yl]piperazin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 142527789 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | methyl 3-cyclopropyl-2-[4-[(3E)-hexa-1,3,5-trien-3-yl]piperazin-1-yl]-3-oxopropanoate |
| SMILES | C=C/C=C(\C=C)N1CCN(C(C(=O)OC)C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C17H24N2O3/c1-4-6-14(5-2)18-9-11-19(12-10-18)15(17(21)22-3)16(20)13-7-8-13/h4-6,13,15H,1-2,7-12H2,3H3/b14-6+ |
| InChIKey | SEQWEZBAQVEEFT-MKMNVTDBSA-N |
| XLogP | 1.38 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|