C19H31NO2 — CID 145107755
cyclopropyl-[1-[3-[(3E)-hepta-1,3-dien-4-yl]oxypropyl]piperidin-4-yl]methanone (PubChem CID 145107755) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is cyclopropyl-[1-[3-[(3E)-hepta-1,3-dien-4-yl]oxypropyl]piperidin-4-yl]methanone.
| Compound Name | cyclopropyl-[1-[3-[(3E)-hepta-1,3-dien-4-yl]oxypropyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 145107755 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | cyclopropyl-[1-[3-[(3E)-hepta-1,3-dien-4-yl]oxypropyl]piperidin-4-yl]methanone |
| SMILES | C=C/C=C(\CCC)OCCCN1CCC(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C19H31NO2/c1-3-6-18(7-4-2)22-15-5-12-20-13-10-17(11-14-20)19(21)16-8-9-16/h3,6,16-17H,1,4-5,7-15H2,2H3/b18-6+ |
| InChIKey | JVDVJNHCPWYTLO-NGYBGAFCSA-N |
| XLogP | 3.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|