C16H26N2O2 — CID 89450106
ethyl 1-[(2Z)-2-[(E)-1-aminoprop-1-enyl]penta-2,4-dienyl]piperidine-4-carboxylate (PubChem CID 89450106) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is ethyl 1-[(2Z)-2-[(E)-1-aminoprop-1-enyl]penta-2,4-dienyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(2Z)-2-[(E)-1-aminoprop-1-enyl]penta-2,4-dienyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 89450106 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | ethyl 1-[(2Z)-2-[(E)-1-aminoprop-1-enyl]penta-2,4-dienyl]piperidine-4-carboxylate |
| SMILES | C=C/C=C(CN1CCC(C(=O)OCC)CC1)\C(N)=C/C |
| InChI | InChI=1S/C16H26N2O2/c1-4-7-14(15(17)5-2)12-18-10-8-13(9-11-18)16(19)20-6-3/h4-5,7,13H,1,6,8-12,17H2,2-3H3/b14-7-,15-5+ |
| InChIKey | AGXQGACTDVDBGL-SATCIOLHSA-N |
| XLogP | 2.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|