C13H23N3O4 — CID 27152328
ethyl 1-[2-(ethylcarbamoylamino)-2-oxoethyl]piperidine-4-carboxylate (PubChem CID 27152328) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is ethyl 1-[2-(ethylcarbamoylamino)-2-oxoethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(ethylcarbamoylamino)-2-oxoethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 27152328 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | ethyl 1-[2-(ethylcarbamoylamino)-2-oxoethyl]piperidine-4-carboxylate |
| SMILES | CCNC(=O)NC(=O)CN1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C13H23N3O4/c1-3-14-13(19)15-11(17)9-16-7-5-10(6-8-16)12(18)20-4-2/h10H,3-9H2,1-2H3,(H2,14,15,17,19) |
| InChIKey | WWPOOINIYROSJK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |