C16H30N4O4 — CID 51102081
tert-butyl N-[[1-[2-(ethylcarbamoylamino)-2-oxoethyl]piperidin-4-yl]methyl]carbamate (PubChem CID 51102081) has the molecular formula C16H30N4O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is tert-butyl N-[[1-[2-(ethylcarbamoylamino)-2-oxoethyl]piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[2-(ethylcarbamoylamino)-2-oxoethyl]piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 51102081 |
| Molecular Formula | C16H30N4O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | tert-butyl N-[[1-[2-(ethylcarbamoylamino)-2-oxoethyl]piperidin-4-yl]methyl]carbamate |
| SMILES | CCNC(=O)NC(=O)CN1CCC(CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30N4O4/c1-5-17-14(22)19-13(21)11-20-8-6-12(7-9-20)10-18-15(23)24-16(2,3)4/h12H,5-11H2,1-4H3,(H,18,23)(H2,17,19,21,22) |
| InChIKey | UETCQVOKYONAJG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |