C18H36N4O3 — CID 54146573
tert-butyl N-[[(3R)-1-[5-(ethylcarbamoylamino)pentyl]pyrrolidin-3-yl]methyl]carbamate (PubChem CID 54146573) has the molecular formula C18H36N4O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-1-[5-(ethylcarbamoylamino)pentyl]pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3R)-1-[5-(ethylcarbamoylamino)pentyl]pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 54146573 |
| Molecular Formula | C18H36N4O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | tert-butyl N-[[(3R)-1-[5-(ethylcarbamoylamino)pentyl]pyrrolidin-3-yl]methyl]carbamate |
| SMILES | CCNC(=O)NCCCCCN1CC[C@H](CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H36N4O3/c1-5-19-16(23)20-10-7-6-8-11-22-12-9-15(14-22)13-21-17(24)25-18(2,3)4/h15H,5-14H2,1-4H3,(H,21,24)(H2,19,20,23)/t15-/m1/s1 |
| InChIKey | OEUOYZZVLJMUIP-OAHLLOKOSA-N |
| XLogP | 2.32 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|