C14H25ClN2O2 — CID 71967835
tert-butyl N-[[1-(2-chloroprop-2-enyl)piperidin-4-yl]methyl]carbamate (PubChem CID 71967835) has the molecular formula C14H25ClN2O2 and a molecular weight of 288.82 g/mol. Its IUPAC name is tert-butyl N-[[1-(2-chloroprop-2-enyl)piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(2-chloroprop-2-enyl)piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 71967835 |
| Molecular Formula | C14H25ClN2O2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | tert-butyl N-[[1-(2-chloroprop-2-enyl)piperidin-4-yl]methyl]carbamate |
| SMILES | C=C(Cl)CN1CCC(CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H25ClN2O2/c1-11(15)10-17-7-5-12(6-8-17)9-16-13(18)19-14(2,3)4/h12H,1,5-10H2,2-4H3,(H,16,18) |
| InChIKey | AWXIQQFHYJQYAM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |