About 2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole
2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole (PubChem CID 142527806) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole.
Molecular Properties
| Compound Name | 2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole |
| PubChem CID | 142527806 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole |
| SMILES | COCCn1cc2c(n1)CNC2 |
| InChI | InChI=1S/C8H13N3O/c1-12-3-2-11-6-7-4-9-5-8(7)10-11/h6,9H,2-5H2,1H3 |
| InChIKey | VFODWGHTUIAMLD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole?
The IUPAC name of 2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole (CID 142527806) is 2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole.
What is the SMILES notation for 2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole?
The canonical SMILES for 2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole is COCCn1cc2c(n1)CNC2.
What is the InChIKey of 2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole?
The InChIKey is VFODWGHTUIAMLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-12-3-2-11-6-7-4-9-5-8(7)10-11/h6,9H,2-5H2,1H3.
What are the key properties of 2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole?
2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole has a molecular weight of 167.21 g/mol, XLogP of 0.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethyl)-5,6-dihydro-4H-pyrrolo[3,4-c]pyrazole is sourced from PubChem (CID 142527806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).