About 2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine
2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine (PubChem CID 145047611) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine.
Molecular Properties
| Compound Name | 2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine |
| PubChem CID | 145047611 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine |
| SMILES | CNN1Cc2cn(CCOC)nc2C1 |
| InChI | InChI=1S/C9H16N4O/c1-10-13-6-8-5-12(3-4-14-2)11-9(8)7-13/h5,10H,3-4,6-7H2,1-2H3 |
| InChIKey | DYDLDOMPEOGOHH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine?
The IUPAC name of 2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine (CID 145047611) is 2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine.
What is the SMILES notation for 2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine?
The canonical SMILES for 2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine is CNN1Cc2cn(CCOC)nc2C1.
What is the InChIKey of 2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine?
The InChIKey is DYDLDOMPEOGOHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O/c1-10-13-6-8-5-12(3-4-14-2)11-9(8)7-13/h5,10H,3-4,6-7H2,1-2H3.
What are the key properties of 2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine?
2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine has a molecular weight of 196.25 g/mol, XLogP of -0.02, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethyl)-N-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-amine is sourced from PubChem (CID 145047611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).