C9H7N3OS — CID 142528425
10-methyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-5-one (PubChem CID 142528425) has the molecular formula C9H7N3OS and a molecular weight of 205.24 g/mol. Its IUPAC name is 10-methyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-5-one.
| Compound Name | 10-methyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-5-one |
|---|---|
| PubChem CID | 142528425 |
| Molecular Formula | C9H7N3OS |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 10-methyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-5-one |
| SMILES | Cc1ccc2c(n1)sc1c(=O)[nH][nH]c12 |
| InChI | InChI=1S/C9H7N3OS/c1-4-2-3-5-6-7(8(13)12-11-6)14-9(5)10-4/h2-3H,1H3,(H2,11,12,13) |
| InChIKey | CARFTKPVZWCNPV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |