C23H42F2N2 — CID 142528853
4,4-difluoro-N-[4-methyl-5-[1-(4-methylpent-4-enyl)piperidin-3-yl]pentyl]cyclohexan-1-amine (PubChem CID 142528853) has the molecular formula C23H42F2N2 and a molecular weight of 384.60 g/mol. Its IUPAC name is 4,4-difluoro-N-[4-methyl-5-[1-(4-methylpent-4-enyl)piperidin-3-yl]pentyl]cyclohexan-1-amine.
| Compound Name | 4,4-difluoro-N-[4-methyl-5-[1-(4-methylpent-4-enyl)piperidin-3-yl]pentyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 142528853 |
| Molecular Formula | C23H42F2N2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.33 |
| IUPAC Name | 4,4-difluoro-N-[4-methyl-5-[1-(4-methylpent-4-enyl)piperidin-3-yl]pentyl]cyclohexan-1-amine |
| SMILES | C=C(C)CCCN1CCCC(CC(C)CCCNC2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C23H42F2N2/c1-19(2)7-5-15-27-16-6-9-21(18-27)17-20(3)8-4-14-26-22-10-12-23(24,25)13-11-22/h20-22,26H,1,4-18H2,2-3H3 |
| InChIKey | SATIQJGAADQUOP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|