C14H24F3N — CID 105162991
N-ethyl-3-methyl-1-[2-(trifluoromethyl)cyclohexyl]but-3-en-1-amine (PubChem CID 105162991) has the molecular formula C14H24F3N and a molecular weight of 263.35 g/mol. Its IUPAC name is N-ethyl-3-methyl-1-[2-(trifluoromethyl)cyclohexyl]but-3-en-1-amine.
| Compound Name | N-ethyl-3-methyl-1-[2-(trifluoromethyl)cyclohexyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 105162991 |
| Molecular Formula | C14H24F3N |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-ethyl-3-methyl-1-[2-(trifluoromethyl)cyclohexyl]but-3-en-1-amine |
| SMILES | C=C(C)CC(NCC)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H24F3N/c1-4-18-13(9-10(2)3)11-7-5-6-8-12(11)14(15,16)17/h11-13,18H,2,4-9H2,1,3H3 |
| InChIKey | LVNLFYJMECCHMX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|