C15H27F2N — CID 178133087
(3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine (PubChem CID 178133087) has the molecular formula C15H27F2N and a molecular weight of 259.38 g/mol. Its IUPAC name is (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine.
| Compound Name | (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine |
|---|---|
| PubChem CID | 178133087 |
| Molecular Formula | C15H27F2N |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine |
| SMILES | C=C(C)[C@@]1(CCC(F)F)CNC[C@H](C(C)(C)C)C1 |
| InChI | InChI=1S/C15H27F2N/c1-11(2)15(7-6-13(16)17)8-12(9-18-10-15)14(3,4)5/h12-13,18H,1,6-10H2,2-5H3/t12-,15-/m1/s1 |
| InChIKey | NQBJOMVZXASLPR-IUODEOHRSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|