About (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine
(3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine (PubChem CID 178133087) has the molecular formula C15H27F2N
and a molecular weight of 259.38 g/mol. Its IUPAC name is (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine.
Molecular Properties
| Compound Name | (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine |
| PubChem CID | 178133087 |
| Molecular Formula | C15H27F2N |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine |
| SMILES | C=C(C)[C@@]1(CCC(F)F)CNC[C@H](C(C)(C)C)C1 |
| InChI | InChI=1S/C15H27F2N/c1-11(2)15(7-6-13(16)17)8-12(9-18-10-15)14(3,4)5/h12-13,18H,1,6-10H2,2-5H3/t12-,15-/m1/s1 |
| InChIKey | NQBJOMVZXASLPR-IUODEOHRSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine?
The IUPAC name of (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine (CID 178133087) is (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine.
What is the SMILES notation for (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine?
The canonical SMILES for (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine is C=C(C)[C@@]1(CCC(F)F)CNC[C@H](C(C)(C)C)C1.
What is the InChIKey of (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine?
The InChIKey is NQBJOMVZXASLPR-IUODEOHRSA-N. The full InChI is InChI=1S/C15H27F2N/c1-11(2)15(7-6-13(16)17)8-12(9-18-10-15)14(3,4)5/h12-13,18H,1,6-10H2,2-5H3/t12-,15-/m1/s1.
What are the key properties of (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine?
(3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine has a molecular weight of 259.38 g/mol, XLogP of 4.25, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-5-tert-butyl-3-(3,3-difluoropropyl)-3-prop-1-en-2-ylpiperidine is sourced from PubChem (CID 178133087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).