C15H27F2N — CID 105164021
1-(4,4-difluorocyclohexyl)-3-methylidene-N-propylpentan-1-amine (PubChem CID 105164021) has the molecular formula C15H27F2N and a molecular weight of 259.38 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-3-methylidene-N-propylpentan-1-amine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-3-methylidene-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 105164021 |
| Molecular Formula | C15H27F2N |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-3-methylidene-N-propylpentan-1-amine |
| SMILES | C=C(CC)CC(NCCC)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C15H27F2N/c1-4-10-18-14(11-12(3)5-2)13-6-8-15(16,17)9-7-13/h13-14,18H,3-11H2,1-2H3 |
| InChIKey | PKSCVCHEKCFTMR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|