C26H46F3N — CID 139457173
N-butyl-2-methylidene-4-[4-[4-(5,5,5-trifluoropentyl)cyclohexyl]cyclohexyl]butan-1-amine (PubChem CID 139457173) has the molecular formula C26H46F3N and a molecular weight of 429.66 g/mol. Its IUPAC name is N-butyl-2-methylidene-4-[4-[4-(5,5,5-trifluoropentyl)cyclohexyl]cyclohexyl]butan-1-amine.
| Compound Name | N-butyl-2-methylidene-4-[4-[4-(5,5,5-trifluoropentyl)cyclohexyl]cyclohexyl]butan-1-amine |
|---|---|
| PubChem CID | 139457173 |
| Molecular Formula | C26H46F3N |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 429.36 |
| IUPAC Name | N-butyl-2-methylidene-4-[4-[4-(5,5,5-trifluoropentyl)cyclohexyl]cyclohexyl]butan-1-amine |
| SMILES | C=C(CCC1CCC(C2CCC(CCCCC(F)(F)F)CC2)CC1)CNCCCC |
| InChI | InChI=1S/C26H46F3N/c1-3-4-19-30-20-21(2)8-9-23-12-16-25(17-13-23)24-14-10-22(11-15-24)7-5-6-18-26(27,28)29/h22-25,30H,2-20H2,1H3 |
| InChIKey | ILCHRJXUUKPUSA-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|