C12H20F3N — CID 105163817
N,2-dimethyl-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-amine (PubChem CID 105163817) has the molecular formula C12H20F3N and a molecular weight of 235.29 g/mol. Its IUPAC name is N,2-dimethyl-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-amine.
| Compound Name | N,2-dimethyl-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 105163817 |
| Molecular Formula | C12H20F3N |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | N,2-dimethyl-1-[4-(trifluoromethyl)cyclohexyl]prop-2-en-1-amine |
| SMILES | C=C(C)C(NC)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H20F3N/c1-8(2)11(16-3)9-4-6-10(7-5-9)12(13,14)15/h9-11,16H,1,4-7H2,2-3H3 |
| InChIKey | XDDPNLIGOYBRAK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|