C17H30F3N — CID 105155375
1-(4-ethylcyclohexyl)-N-methyl-1-[4-(trifluoromethyl)cyclohexyl]methanamine (PubChem CID 105155375) has the molecular formula C17H30F3N and a molecular weight of 305.43 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-N-methyl-1-[4-(trifluoromethyl)cyclohexyl]methanamine.
| Compound Name | 1-(4-ethylcyclohexyl)-N-methyl-1-[4-(trifluoromethyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 105155375 |
| Molecular Formula | C17H30F3N |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-N-methyl-1-[4-(trifluoromethyl)cyclohexyl]methanamine |
| SMILES | CCC1CCC(C(NC)C2CCC(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C17H30F3N/c1-3-12-4-6-13(7-5-12)16(21-2)14-8-10-15(11-9-14)17(18,19)20/h12-16,21H,3-11H2,1-2H3 |
| InChIKey | CBZTWCIYXRXPBX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |