C17H27F3 — CID 101139962
1-ethyl-4-[(E)-2-[4-(trifluoromethyl)cyclohexyl]ethenyl]cyclohexane (PubChem CID 101139962) has the molecular formula C17H27F3 and a molecular weight of 288.40 g/mol. Its IUPAC name is 1-ethyl-4-[(E)-2-[4-(trifluoromethyl)cyclohexyl]ethenyl]cyclohexane.
| Compound Name | 1-ethyl-4-[(E)-2-[4-(trifluoromethyl)cyclohexyl]ethenyl]cyclohexane |
|---|---|
| PubChem CID | 101139962 |
| Molecular Formula | C17H27F3 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 1-ethyl-4-[(E)-2-[4-(trifluoromethyl)cyclohexyl]ethenyl]cyclohexane |
| SMILES | CCC1CCC(/C=C/C2CCC(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C17H27F3/c1-2-13-3-5-14(6-4-13)7-8-15-9-11-16(12-10-15)17(18,19)20/h7-8,13-16H,2-6,9-12H2,1H3/b8-7+ |
| InChIKey | AYLVMGOJEUXNIV-BQYQJAHWSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|