C15H25F3O — CID 64756338
1-(4-ethylcyclohexyl)-4-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 64756338) has the molecular formula C15H25F3O and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-4-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-(4-ethylcyclohexyl)-4-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 64756338 |
| Molecular Formula | C15H25F3O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-4-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | CCC1CCC(C2(O)CCC(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C15H25F3O/c1-2-11-3-5-12(6-4-11)14(19)9-7-13(8-10-14)15(16,17)18/h11-13,19H,2-10H2,1H3 |
| InChIKey | HLNFUPYKNBBPNN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |