C14H23F3O — CID 15537559
1,1-dicyclohexyl-2,2,2-trifluoroethanol (PubChem CID 15537559) has the molecular formula C14H23F3O and a molecular weight of 264.33 g/mol. Its IUPAC name is 1,1-dicyclohexyl-2,2,2-trifluoroethanol.
| Compound Name | 1,1-dicyclohexyl-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 15537559 |
| Molecular Formula | C14H23F3O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 1,1-dicyclohexyl-2,2,2-trifluoroethanol |
| SMILES | OC(C1CCCCC1)(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C14H23F3O/c15-14(16,17)13(18,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12,18H,1-10H2 |
| InChIKey | XBPSILIXMWYCHD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |