C10H14F6O — CID 20826489
2-(cyclohexylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 20826489) has the molecular formula C10H14F6O and a molecular weight of 264.21 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(cyclohexylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 20826489 |
| Molecular Formula | C10H14F6O |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-(cyclohexylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(CC1CCCCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H14F6O/c11-9(12,13)8(17,10(14,15)16)6-7-4-2-1-3-5-7/h7,17H,1-6H2 |
| InChIKey | SKAJIPYBAYDIFY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |