C8H11F5O — CID 13495698
1-(1,1,2,2,2-pentafluoroethyl)cyclohexan-1-ol (PubChem CID 13495698) has the molecular formula C8H11F5O and a molecular weight of 218.16 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentafluoroethyl)cyclohexan-1-ol.
| Compound Name | 1-(1,1,2,2,2-pentafluoroethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 13495698 |
| Molecular Formula | C8H11F5O |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 1-(1,1,2,2,2-pentafluoroethyl)cyclohexan-1-ol |
| SMILES | OC1(C(F)(F)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C8H11F5O/c9-7(10,8(11,12)13)6(14)4-2-1-3-5-6/h14H,1-5H2 |
| InChIKey | BCIAAKHEIJXXKJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|