C14H21F5O — CID 20743918
2,2,2-trifluoro-1,1-bis(4-fluorocyclohexyl)ethanol (PubChem CID 20743918) has the molecular formula C14H21F5O and a molecular weight of 300.31 g/mol. Its IUPAC name is 2,2,2-trifluoro-1,1-bis(4-fluorocyclohexyl)ethanol.
| Compound Name | 2,2,2-trifluoro-1,1-bis(4-fluorocyclohexyl)ethanol |
|---|---|
| PubChem CID | 20743918 |
| Molecular Formula | C14H21F5O |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2,2,2-trifluoro-1,1-bis(4-fluorocyclohexyl)ethanol |
| SMILES | OC(C1CCC(F)CC1)(C1CCC(F)CC1)C(F)(F)F |
| InChI | InChI=1S/C14H21F5O/c15-11-5-1-9(2-6-11)13(20,14(17,18)19)10-3-7-12(16)8-4-10/h9-12,20H,1-8H2 |
| InChIKey | GKRMDIYMJIAXNV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |