C11H19F3O — CID 14270574
4-tert-butyl-1-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 14270574) has the molecular formula C11H19F3O and a molecular weight of 224.27 g/mol. Its IUPAC name is 4-tert-butyl-1-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 4-tert-butyl-1-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 14270574 |
| Molecular Formula | C11H19F3O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 4-tert-butyl-1-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | CC(C)(C)C1CCC(O)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H19F3O/c1-9(2,3)8-4-6-10(15,7-5-8)11(12,13)14/h8,15H,4-7H2,1-3H3 |
| InChIKey | LELXUBDAVIEFCC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |