C17H25F7 — CID 101139965
1-ethyl-4-[1,1,2,2-tetrafluoro-2-[4-(trifluoromethyl)cyclohexyl]ethyl]cyclohexane (PubChem CID 101139965) has the molecular formula C17H25F7 and a molecular weight of 362.37 g/mol. Its IUPAC name is 1-ethyl-4-[1,1,2,2-tetrafluoro-2-[4-(trifluoromethyl)cyclohexyl]ethyl]cyclohexane.
| Compound Name | 1-ethyl-4-[1,1,2,2-tetrafluoro-2-[4-(trifluoromethyl)cyclohexyl]ethyl]cyclohexane |
|---|---|
| PubChem CID | 101139965 |
| Molecular Formula | C17H25F7 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-ethyl-4-[1,1,2,2-tetrafluoro-2-[4-(trifluoromethyl)cyclohexyl]ethyl]cyclohexane |
| SMILES | CCC1CCC(C(F)(F)C(F)(F)C2CCC(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C17H25F7/c1-2-11-3-5-12(6-4-11)15(18,19)16(20,21)13-7-9-14(10-8-13)17(22,23)24/h11-14H,2-10H2,1H3 |
| InChIKey | IABRHRPELNZRRK-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|