C12H21F3O — CID 105096783
2,2-dimethyl-1-[4-(trifluoromethyl)cyclohexyl]propan-1-ol (PubChem CID 105096783) has the molecular formula C12H21F3O and a molecular weight of 238.29 g/mol. Its IUPAC name is 2,2-dimethyl-1-[4-(trifluoromethyl)cyclohexyl]propan-1-ol.
| Compound Name | 2,2-dimethyl-1-[4-(trifluoromethyl)cyclohexyl]propan-1-ol |
|---|---|
| PubChem CID | 105096783 |
| Molecular Formula | C12H21F3O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2,2-dimethyl-1-[4-(trifluoromethyl)cyclohexyl]propan-1-ol |
| SMILES | CC(C)(C)C(O)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H21F3O/c1-11(2,3)10(16)8-4-6-9(7-5-8)12(13,14)15/h8-10,16H,4-7H2,1-3H3 |
| InChIKey | NMNKUWJAEYPWQZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |