C13H23F2N — CID 105163705
1-(4,4-difluorocyclohexyl)-2-methyl-N-propylprop-2-en-1-amine (PubChem CID 105163705) has the molecular formula C13H23F2N and a molecular weight of 231.33 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-2-methyl-N-propylprop-2-en-1-amine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-2-methyl-N-propylprop-2-en-1-amine |
|---|---|
| PubChem CID | 105163705 |
| Molecular Formula | C13H23F2N |
| Molecular Weight | 231.33 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-2-methyl-N-propylprop-2-en-1-amine |
| SMILES | C=C(C)C(NCCC)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H23F2N/c1-4-9-16-12(10(2)3)11-5-7-13(14,15)8-6-11/h11-12,16H,2,4-9H2,1,3H3 |
| InChIKey | JULZNCUHWWYJGU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|