C21H40O2 — CID 142528980
14,14-dimethylpentadec-1-en-6-yl 2-methylpropanoate (PubChem CID 142528980) has the molecular formula C21H40O2 and a molecular weight of 324.55 g/mol. Its IUPAC name is 14,14-dimethylpentadec-1-en-6-yl 2-methylpropanoate.
| Compound Name | 14,14-dimethylpentadec-1-en-6-yl 2-methylpropanoate |
|---|---|
| PubChem CID | 142528980 |
| Molecular Formula | C21H40O2 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | 14,14-dimethylpentadec-1-en-6-yl 2-methylpropanoate |
| SMILES | C=CCCCC(CCCCCCCC(C)(C)C)OC(=O)C(C)C |
| InChI | InChI=1S/C21H40O2/c1-7-8-12-15-19(23-20(22)18(2)3)16-13-10-9-11-14-17-21(4,5)6/h7,18-19H,1,8-17H2,2-6H3 |
| InChIKey | PUGWDHWLXFOIJM-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|