C15H24O4 — CID 154418165
(6,6-dimethyl-1-prop-2-enoyloxyheptyl) prop-2-enoate (PubChem CID 154418165) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (6,6-dimethyl-1-prop-2-enoyloxyheptyl) prop-2-enoate.
| Compound Name | (6,6-dimethyl-1-prop-2-enoyloxyheptyl) prop-2-enoate |
|---|---|
| PubChem CID | 154418165 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (6,6-dimethyl-1-prop-2-enoyloxyheptyl) prop-2-enoate |
| SMILES | C=CC(=O)OC(CCCCC(C)(C)C)OC(=O)C=C |
| InChI | InChI=1S/C15H24O4/c1-6-12(16)18-14(19-13(17)7-2)10-8-9-11-15(3,4)5/h6-7,14H,1-2,8-11H2,3-5H3 |
| InChIKey | MVHIIXOZPPVYLQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|