C14H22O6 — CID 142740380
(4,6-dihydroxy-6-methyl-1-prop-2-enoyloxyheptyl) prop-2-enoate (PubChem CID 142740380) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is (4,6-dihydroxy-6-methyl-1-prop-2-enoyloxyheptyl) prop-2-enoate.
| Compound Name | (4,6-dihydroxy-6-methyl-1-prop-2-enoyloxyheptyl) prop-2-enoate |
|---|---|
| PubChem CID | 142740380 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (4,6-dihydroxy-6-methyl-1-prop-2-enoyloxyheptyl) prop-2-enoate |
| SMILES | C=CC(=O)OC(CCC(O)CC(C)(C)O)OC(=O)C=C |
| InChI | InChI=1S/C14H22O6/c1-5-11(16)19-13(20-12(17)6-2)8-7-10(15)9-14(3,4)18/h5-6,10,13,15,18H,1-2,7-9H2,3-4H3 |
| InChIKey | KAUJCFVCJLIURO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|