C18H22O4 — CID 142529038
ethyl 2-[4-(2,2-dimethyl-4-oxohex-5-enyl)phenyl]-2-oxoacetate (PubChem CID 142529038) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is ethyl 2-[4-(2,2-dimethyl-4-oxohex-5-enyl)phenyl]-2-oxoacetate.
| Compound Name | ethyl 2-[4-(2,2-dimethyl-4-oxohex-5-enyl)phenyl]-2-oxoacetate |
|---|---|
| PubChem CID | 142529038 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | ethyl 2-[4-(2,2-dimethyl-4-oxohex-5-enyl)phenyl]-2-oxoacetate |
| SMILES | C=CC(=O)CC(C)(C)Cc1ccc(C(=O)C(=O)OCC)cc1 |
| InChI | InChI=1S/C18H22O4/c1-5-15(19)12-18(3,4)11-13-7-9-14(10-8-13)16(20)17(21)22-6-2/h5,7-10H,1,6,11-12H2,2-4H3 |
| InChIKey | VJUPWZFFWFEZQW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|