About ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide
ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide (PubChem CID 142529017) has the molecular formula C17H23NO4
and a molecular weight of 305.37 g/mol. Its IUPAC name is ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide.
Molecular Properties
| Compound Name | ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide |
| PubChem CID | 142529017 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide |
| SMILES | C=CC(=O)NCCC.CCOC(=O)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H12O3.C6H11NO/c1-3-14-11(13)10(12)9-6-4-8(2)5-7-9;1-3-5-7-6(8)4-2/h4-7H,3H2,1-2H3;4H,2-3,5H2,1H3,(H,7,8) |
| InChIKey | FFERLGKHULBQLF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide?
The IUPAC name of ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide (CID 142529017) is ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide.
What is the SMILES notation for ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide?
The canonical SMILES for ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide is C=CC(=O)NCCC.CCOC(=O)C(=O)c1ccc(C)cc1.
What is the InChIKey of ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide?
The InChIKey is FFERLGKHULBQLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3.C6H11NO/c1-3-14-11(13)10(12)9-6-4-8(2)5-7-9;1-3-5-7-6(8)4-2/h4-7H,3H2,1-2H3;4H,2-3,5H2,1H3,(H,7,8).
What are the key properties of ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide?
ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide has a molecular weight of 305.37 g/mol, XLogP of 2.44, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-methylphenyl)-2-oxoacetate;N-propylprop-2-enamide is sourced from PubChem (CID 142529017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).