C12H17ClFNO2 — CID 142529146
methyl 3-(2-amino-4-fluoro-3,5-dimethylphenyl)propanoate;hydrochloride (PubChem CID 142529146) has the molecular formula C12H17ClFNO2 and a molecular weight of 261.72 g/mol. Its IUPAC name is methyl 3-(2-amino-4-fluoro-3,5-dimethylphenyl)propanoate;hydrochloride.
| Compound Name | methyl 3-(2-amino-4-fluoro-3,5-dimethylphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 142529146 |
| Molecular Formula | C12H17ClFNO2 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | methyl 3-(2-amino-4-fluoro-3,5-dimethylphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)CCc1cc(C)c(F)c(C)c1N.Cl |
| InChI | InChI=1S/C12H16FNO2.ClH/c1-7-6-9(4-5-10(15)16-3)12(14)8(2)11(7)13;/h6H,4-5,14H2,1-3H3;1H |
| InChIKey | GJUWVHOTFXINLT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|