C17H19F3N3O3+ — CID 142529902
3-[4-(5-methyl-2-pyridinyl)pyridazin-1-ium-1-yl]propanoic acid;3,3,3-trifluoro-2-methoxyprop-1-ene (PubChem CID 142529902) has the molecular formula C17H19F3N3O3+ and a molecular weight of 370.35 g/mol. Its IUPAC name is 3-[4-(5-methyl-2-pyridinyl)pyridazin-1-ium-1-yl]propanoic acid;3,3,3-trifluoro-2-methoxyprop-1-ene.
| Compound Name | 3-[4-(5-methyl-2-pyridinyl)pyridazin-1-ium-1-yl]propanoic acid;3,3,3-trifluoro-2-methoxyprop-1-ene |
|---|---|
| PubChem CID | 142529902 |
| Molecular Formula | C17H19F3N3O3+ |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-[4-(5-methyl-2-pyridinyl)pyridazin-1-ium-1-yl]propanoic acid;3,3,3-trifluoro-2-methoxyprop-1-ene |
| SMILES | C=C(OC)C(F)(F)F.Cc1ccc(-c2cc[n+](CCC(=O)O)nc2)nc1 |
| InChI | InChI=1S/C13H13N3O2.C4H5F3O/c1-10-2-3-12(14-8-10)11-4-6-16(15-9-11)7-5-13(17)18;1-3(8-2)4(5,6)7/h2-4,6,8-9H,5,7H2,1H3;1H2,2H3/p+1 |
| InChIKey | HVXVIVDSTMVLAW-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|