C15H19IN3O4+ — CID 142531118
[1-iodooxy-2-[methyl-[(E)-4-[4-(methylcarbamoyl)anilino]-4-oxobut-2-enyl]amino]ethylidene]oxidanium (PubChem CID 142531118) has the molecular formula C15H19IN3O4+ and a molecular weight of 432.24 g/mol. Its IUPAC name is [1-iodooxy-2-[methyl-[(E)-4-[4-(methylcarbamoyl)anilino]-4-oxobut-2-enyl]amino]ethylidene]oxidanium.
| Compound Name | [1-iodooxy-2-[methyl-[(E)-4-[4-(methylcarbamoyl)anilino]-4-oxobut-2-enyl]amino]ethylidene]oxidanium |
|---|---|
| PubChem CID | 142531118 |
| Molecular Formula | C15H19IN3O4+ |
| Molecular Weight | 432.24 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | [1-iodooxy-2-[methyl-[(E)-4-[4-(methylcarbamoyl)anilino]-4-oxobut-2-enyl]amino]ethylidene]oxidanium |
| SMILES | [H]/[O+]=C(/CN(C)C/C=C/C(=O)Nc1ccc(C(=O)NC)cc1)OI |
| InChI | InChI=1S/C15H18IN3O4/c1-17-15(22)11-5-7-12(8-6-11)18-13(20)4-3-9-19(2)10-14(21)23-16/h3-8H,9-10H2,1-2H3,(H,17,22)(H,18,20)/p+1/b4-3+ |
| InChIKey | AKAMSZFSVUDQJZ-ONEGZZNKSA-O |
| XLogP | 1.34 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|