About ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine
ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine (PubChem CID 142531422) has the molecular formula C13H28N2
and a molecular weight of 212.38 g/mol. Its IUPAC name is ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine.
Molecular Properties
| Compound Name | ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine |
| PubChem CID | 142531422 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C=C\C.CC.CCNC(C)C |
| InChI | InChI=1S/C6H9N.C5H13N.C2H6/c1-3-5-7-6-4-2;1-4-6-5(2)3;1-2/h3-6H,1H2,2H3;5-6H,4H2,1-3H3;1-2H3/b6-4-,7-5+;; |
| InChIKey | OCUZEEVXNTWORF-YVCKSLIESA-N |
| XLogP | 3.81 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine?
The IUPAC name of ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine (CID 142531422) is ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine.
What is the SMILES notation for ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine?
The canonical SMILES for ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine is C=C/C=N/C=C\C.CC.CCNC(C)C.
What is the InChIKey of ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine?
The InChIKey is OCUZEEVXNTWORF-YVCKSLIESA-N. The full InChI is InChI=1S/C6H9N.C5H13N.C2H6/c1-3-5-7-6-4-2;1-4-6-5(2)3;1-2/h3-6H,1H2,2H3;5-6H,4H2,1-3H3;1-2H3/b6-4-,7-5+;;.
What are the key properties of ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine?
ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine has a molecular weight of 212.38 g/mol, XLogP of 3.81, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethylpropan-2-amine;N-[(Z)-prop-1-enyl]prop-2-en-1-imine is sourced from PubChem (CID 142531422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).