C31H41ClN2O2S — CID 142532626
20-(4-chloro-2-propylphenyl)-9,10-dimethyl-11-methylidene-18-oxa-11λ4-thia-1,12-diazatetracyclo[12.7.2.03,6.017,22]tricosa-14(23),15,17(22)-trien-13-one (PubChem CID 142532626) has the molecular formula C31H41ClN2O2S and a molecular weight of 541.20 g/mol. Its IUPAC name is 20-(4-chloro-2-propylphenyl)-9,10-dimethyl-11-methylidene-18-oxa-11λ4-thia-1,12-diazatetracyclo[12.7.2.03,6.017,22]tricosa-14(23),15,17(22)-trien-13-one.
| Compound Name | 20-(4-chloro-2-propylphenyl)-9,10-dimethyl-11-methylidene-18-oxa-11λ4-thia-1,12-diazatetracyclo[12.7.2.03,6.017,22]tricosa-14(23),15,17(22)-trien-13-one |
|---|---|
| PubChem CID | 142532626 |
| Molecular Formula | C31H41ClN2O2S |
| Molecular Weight | 541.20 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | 20-(4-chloro-2-propylphenyl)-9,10-dimethyl-11-methylidene-18-oxa-11λ4-thia-1,12-diazatetracyclo[12.7.2.03,6.017,22]tricosa-14(23),15,17(22)-trien-13-one |
| SMILES | C=S1NC(=O)c2ccc3c(c2)N(CC(c2ccc(Cl)cc2CCC)CO3)CC2CCC2CCC(C)C1C |
| InChI | InChI=1S/C31H41ClN2O2S/c1-5-6-23-15-27(32)12-13-28(23)26-18-34-17-25-10-9-22(25)8-7-20(2)21(3)37(4)33-31(35)24-11-14-30(36-19-26)29(34)16-24/h11-16,20-22,25-26H,4-10,17-19H2,1-3H3,(H,33,35) |
| InChIKey | XVRRVIXFPXIDEI-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.20 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|