C20H23N5OS — CID 142533170
4-[2-(benzimidazol-1-yl)-6-(thiolan-2-yl)pyrimidin-4-yl]-3-methylmorpholine (PubChem CID 142533170) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is 4-[2-(benzimidazol-1-yl)-6-(thiolan-2-yl)pyrimidin-4-yl]-3-methylmorpholine.
| Compound Name | 4-[2-(benzimidazol-1-yl)-6-(thiolan-2-yl)pyrimidin-4-yl]-3-methylmorpholine |
|---|---|
| PubChem CID | 142533170 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-[2-(benzimidazol-1-yl)-6-(thiolan-2-yl)pyrimidin-4-yl]-3-methylmorpholine |
| SMILES | CC1COCCN1c1cc(C2CCCS2)nc(-n2cnc3ccccc32)n1 |
| InChI | InChI=1S/C20H23N5OS/c1-14-12-26-9-8-24(14)19-11-16(18-7-4-10-27-18)22-20(23-19)25-13-21-15-5-2-3-6-17(15)25/h2-3,5-6,11,13-14,18H,4,7-10,12H2,1H3 |
| InChIKey | IYJOGWIUISCBAO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |