C20H28N6O2S — CID 142518114
2-(benzimidazol-1-yl)-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine;methanethiol;oxetane (PubChem CID 142518114) has the molecular formula C20H28N6O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is 2-(benzimidazol-1-yl)-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine;methanethiol;oxetane.
| Compound Name | 2-(benzimidazol-1-yl)-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine;methanethiol;oxetane |
|---|---|
| PubChem CID | 142518114 |
| Molecular Formula | C20H28N6O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-(benzimidazol-1-yl)-6-(3-methylmorpholin-4-yl)pyrimidin-4-amine;methanethiol;oxetane |
| SMILES | C1COC1.CC1COCCN1c1cc(N)nc(-n2cnc3ccccc32)n1.CS |
| InChI | InChI=1S/C16H18N6O.C3H6O.CH4S/c1-11-9-23-7-6-21(11)15-8-14(17)19-16(20-15)22-10-18-12-4-2-3-5-13(12)22;1-2-4-3-1;1-2/h2-5,8,10-11H,6-7,9H2,1H3,(H2,17,19,20);1-3H2;2H,1H3 |
| InChIKey | FGCFUCKUXKVXPL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|